C15H18O5 — CID 102027798
(1aS,4S,4aS,6S,8R,8aS)-4-(furan-3-yl)-6-hydroxy-4a,8-dimethyl-1a,4,5,6,7,8-hexahydrooxireno[2,3-d]isochromen-2-one (PubChem CID 102027798) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1aS,4S,4aS,6S,8R,8aS)-4-(furan-3-yl)-6-hydroxy-4a,8-dimethyl-1a,4,5,6,7,8-hexahydrooxireno[2,3-d]isochromen-2-one.
| Compound Name | (1aS,4S,4aS,6S,8R,8aS)-4-(furan-3-yl)-6-hydroxy-4a,8-dimethyl-1a,4,5,6,7,8-hexahydrooxireno[2,3-d]isochromen-2-one |
|---|---|
| PubChem CID | 102027798 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1aS,4S,4aS,6S,8R,8aS)-4-(furan-3-yl)-6-hydroxy-4a,8-dimethyl-1a,4,5,6,7,8-hexahydrooxireno[2,3-d]isochromen-2-one |
| SMILES | C[C@@H]1C[C@H](O)C[C@@]2(C)[C@H](c3ccoc3)OC(=O)[C@H]3O[C@]132 |
| InChI | InChI=1S/C15H18O5/c1-8-5-10(16)6-14(2)11(9-3-4-18-7-9)19-13(17)12-15(8,14)20-12/h3-4,7-8,10-12,16H,5-6H2,1-2H3/t8-,10+,11+,12-,14+,15-/m1/s1 |
| InChIKey | MZTXXUYQONWXTD-RRCQKJJWSA-N |
| XLogP | 1.81 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|