C13H18O6S — CID 138972120
(1S,7R,11R,12R)-9,9,14,14-tetramethyl-3,5,8,10,13,15-hexaoxatetracyclo[10.3.0.02,6.07,11]pentadecane-4-thione (PubChem CID 138972120) has the molecular formula C13H18O6S and a molecular weight of 302.35 g/mol. Its IUPAC name is (1S,7R,11R,12R)-9,9,14,14-tetramethyl-3,5,8,10,13,15-hexaoxatetracyclo[10.3.0.02,6.07,11]pentadecane-4-thione.
| Compound Name | (1S,7R,11R,12R)-9,9,14,14-tetramethyl-3,5,8,10,13,15-hexaoxatetracyclo[10.3.0.02,6.07,11]pentadecane-4-thione |
|---|---|
| PubChem CID | 138972120 |
| Molecular Formula | C13H18O6S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1S,7R,11R,12R)-9,9,14,14-tetramethyl-3,5,8,10,13,15-hexaoxatetracyclo[10.3.0.02,6.07,11]pentadecane-4-thione |
| SMILES | CC1(C)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3C3OC(=S)OC3[C@H]2O1 |
| InChI | InChI=1S/C13H18O6S/c1-12(2)16-7-5-6(15-11(20)14-5)8-10(9(7)18-12)19-13(3,4)17-8/h5-10H,1-4H3/t5?,6?,7-,8+,9-,10-/m0/s1 |
| InChIKey | PDBDIWWZSBHPJA-JIKFUSCKSA-N |
| XLogP | 1.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|