C9H11ClO5 — CID 14505954
9-chloro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 14505954) has the molecular formula C9H11ClO5 and a molecular weight of 234.63 g/mol. Its IUPAC name is 9-chloro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | 9-chloro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 14505954 |
| Molecular Formula | C9H11ClO5 |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 9-chloro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1(C)OC2OC3C(Cl)C(=O)OC3C2O1 |
| InChI | InChI=1S/C9H11ClO5/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8H,1-2H3 |
| InChIKey | MYUXZGNHTJQYFX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|