C9H13O6P — CID 23418548
(2R,4R,8R,9S)-6,6-dimethyl-3,5,7,10,12,14-hexaoxa-11-phosphatetracyclo[9.2.1.02,9.04,8]tetradecane (PubChem CID 23418548) has the molecular formula C9H13O6P and a molecular weight of 248.17 g/mol. Its IUPAC name is (2R,4R,8R,9S)-6,6-dimethyl-3,5,7,10,12,14-hexaoxa-11-phosphatetracyclo[9.2.1.02,9.04,8]tetradecane.
| Compound Name | (2R,4R,8R,9S)-6,6-dimethyl-3,5,7,10,12,14-hexaoxa-11-phosphatetracyclo[9.2.1.02,9.04,8]tetradecane |
|---|---|
| PubChem CID | 23418548 |
| Molecular Formula | C9H13O6P |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (2R,4R,8R,9S)-6,6-dimethyl-3,5,7,10,12,14-hexaoxa-11-phosphatetracyclo[9.2.1.02,9.04,8]tetradecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C4COP(O4)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C9H13O6P/c1-9(2)12-7-6-5(11-8(7)13-9)4-3-10-16(14-4)15-6/h4-8H,3H2,1-2H3/t4?,5-,6+,7-,8-,16?/m1/s1 |
| InChIKey | UNOGDKCCKCWOEO-XJOCSDQMSA-N |
| XLogP | 0.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|