C12H17NO4S — CID 11065551
(1S,2R,6R,8R,12R,13S)-4,4,12-trimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecane-11-thione (PubChem CID 11065551) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (1S,2R,6R,8R,12R,13S)-4,4,12-trimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecane-11-thione.
| Compound Name | (1S,2R,6R,8R,12R,13S)-4,4,12-trimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecane-11-thione |
|---|---|
| PubChem CID | 11065551 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (1S,2R,6R,8R,12R,13S)-4,4,12-trimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecane-11-thione |
| SMILES | C[C@H]1C(=S)N2C[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3O[C@@H]12 |
| InChI | InChI=1S/C12H17NO4S/c1-5-9-13(10(5)18)4-6-7(15-9)8-11(14-6)17-12(2,3)16-8/h5-9,11H,4H2,1-3H3/t5-,6-,7+,8-,9+,11-/m1/s1 |
| InChIKey | UUZKEMYBJHEVKN-RUEXUQCSSA-N |
| XLogP | 0.87 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|