C13H17NO7 — CID 23246021
[(1S,2R,6R,8R,12S,13R)-4,4-dimethyl-11-oxo-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-12-yl] acetate (PubChem CID 23246021) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is [(1S,2R,6R,8R,12S,13R)-4,4-dimethyl-11-oxo-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-12-yl] acetate.
| Compound Name | [(1S,2R,6R,8R,12S,13R)-4,4-dimethyl-11-oxo-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-12-yl] acetate |
|---|---|
| PubChem CID | 23246021 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [(1S,2R,6R,8R,12S,13R)-4,4-dimethyl-11-oxo-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N2C[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3O[C@H]12 |
| InChI | InChI=1S/C13H17NO7/c1-5(15)17-9-10(16)14-4-6-7(19-11(9)14)8-12(18-6)21-13(2,3)20-8/h6-9,11-12H,4H2,1-3H3/t6-,7+,8-,9-,11-,12-/m1/s1 |
| InChIKey | WKRGAIUCYXGGEX-PWWDDMIZSA-N |
| XLogP | -0.64 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |