C18H20N2O8 — CID 15427979
(1S,2R,6R,8R,12R,13R)-12-[hydroxy-(4-nitrophenyl)methyl]-4,4-dimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-11-one (PubChem CID 15427979) has the molecular formula C18H20N2O8 and a molecular weight of 392.36 g/mol. Its IUPAC name is (1S,2R,6R,8R,12R,13R)-12-[hydroxy-(4-nitrophenyl)methyl]-4,4-dimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-11-one.
| Compound Name | (1S,2R,6R,8R,12R,13R)-12-[hydroxy-(4-nitrophenyl)methyl]-4,4-dimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-11-one |
|---|---|
| PubChem CID | 15427979 |
| Molecular Formula | C18H20N2O8 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (1S,2R,6R,8R,12R,13R)-12-[hydroxy-(4-nitrophenyl)methyl]-4,4-dimethyl-3,5,7,14-tetraoxa-10-azatetracyclo[6.6.0.02,6.010,13]tetradecan-11-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CN4C(=O)[C@H](C(O)c5ccc([N+](=O)[O-])cc5)[C@H]4O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C18H20N2O8/c1-18(2)27-14-13-10(25-17(14)28-18)7-19-15(22)11(16(19)26-13)12(21)8-3-5-9(6-4-8)20(23)24/h3-6,10-14,16-17,21H,7H2,1-2H3/t10-,11+,12?,13+,14-,16-,17-/m1/s1 |
| InChIKey | SFOULCKQFYVRJW-ODVBOTQQSA-N |
| XLogP | 0.69 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|