C11H11NO4 — CID 11276065
(2S)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one (PubChem CID 11276065) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (2S)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one.
| Compound Name | (2S)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 11276065 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2S)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one |
| SMILES | O=C1CC[C@H]1[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11NO4/c13-10-6-5-9(10)11(14)7-1-3-8(4-2-7)12(15)16/h1-4,9,11,14H,5-6H2/t9-,11+/m1/s1 |
| InChIKey | MUGCRBQKEJGGEI-KOLCDFICSA-N |
| XLogP | 1.61 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|