C17H16NO4S+ — CID 101338374
(3R)-3-[(R)-hydroxy-(4-nitrophenyl)methyl]-1-methyl-2,3-dihydrothiochromen-1-ium-4-one (PubChem CID 101338374) has the molecular formula C17H16NO4S+ and a molecular weight of 330.39 g/mol. Its IUPAC name is (3R)-3-[(R)-hydroxy-(4-nitrophenyl)methyl]-1-methyl-2,3-dihydrothiochromen-1-ium-4-one.
| Compound Name | (3R)-3-[(R)-hydroxy-(4-nitrophenyl)methyl]-1-methyl-2,3-dihydrothiochromen-1-ium-4-one |
|---|---|
| PubChem CID | 101338374 |
| Molecular Formula | C17H16NO4S+ |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3R)-3-[(R)-hydroxy-(4-nitrophenyl)methyl]-1-methyl-2,3-dihydrothiochromen-1-ium-4-one |
| SMILES | C[S+]1C[C@H]([C@@H](O)c2ccc([N+](=O)[O-])cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H16NO4S/c1-23-10-14(17(20)13-4-2-3-5-15(13)23)16(19)11-6-8-12(9-7-11)18(21)22/h2-9,14,16,19H,10H2,1H3/q+1/t14-,16+,23?/m1/s1 |
| InChIKey | LFCREMZMEPQMMB-MNJWVGMUSA-N |
| XLogP | 2.75 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|