C17H21NO5 — CID 132545037
trans-(2S,4R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-4-(3-oxobutyl)cyclohexan-1-one (PubChem CID 132545037) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is trans-(2S,4R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-4-(3-oxobutyl)cyclohexan-1-one.
| Compound Name | trans-(2S,4R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-4-(3-oxobutyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 132545037 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | trans-(2S,4R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-4-(3-oxobutyl)cyclohexan-1-one |
| SMILES | CC(=O)CC[C@@H]1CCC(=O)[C@H]([C@@H](O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H21NO5/c1-11(19)2-3-12-4-9-16(20)15(10-12)17(21)13-5-7-14(8-6-13)18(22)23/h5-8,12,15,17,21H,2-4,9-10H2,1H3/t12-,15-,17+/m1/s1 |
| InChIKey | QHTIXIBASBRCTI-VMGRFDJRSA-N |
| XLogP | 2.98 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|