C16H17NO5 — CID 102522770
[(R)-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]-(4-nitrophenyl)methyl] acetate (PubChem CID 102522770) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(R)-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]-(4-nitrophenyl)methyl] acetate.
| Compound Name | [(R)-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]-(4-nitrophenyl)methyl] acetate |
|---|---|
| PubChem CID | 102522770 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [(R)-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]-(4-nitrophenyl)methyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CCC(C)=CC1=O |
| InChI | InChI=1S/C16H17NO5/c1-10-3-8-14(15(19)9-10)16(22-11(2)18)12-4-6-13(7-5-12)17(20)21/h4-7,9,14,16H,3,8H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | GIIHSDDPOXALPQ-ZBFHGGJFSA-N |
| XLogP | 3.12 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|