C18H19N3O4 — CID 139081496
(R)-(4-nitrophenyl)-[(3S)-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-yl]methanol;hydrate (PubChem CID 139081496) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (R)-(4-nitrophenyl)-[(3S)-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-yl]methanol;hydrate.
| Compound Name | (R)-(4-nitrophenyl)-[(3S)-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-yl]methanol;hydrate |
|---|---|
| PubChem CID | 139081496 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (R)-(4-nitrophenyl)-[(3S)-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-yl]methanol;hydrate |
| SMILES | O.O=[N+]([O-])c1ccc([C@H](O)[C@H]2CCN3Cc4ccccc4N=C23)cc1 |
| InChI | InChI=1S/C18H17N3O3.H2O/c22-17(12-5-7-14(8-6-12)21(23)24)15-9-10-20-11-13-3-1-2-4-16(13)19-18(15)20;/h1-8,15,17,22H,9-11H2;1H2/t15-,17+;/m1./s1 |
| InChIKey | OYVRORLLYLMAJX-KALLACGZSA-N |
| XLogP | 2.37 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|