About cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one
cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one (PubChem CID 139190935) has the molecular formula C17H14ClNO4
and a molecular weight of 331.76 g/mol. Its IUPAC name is cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one |
| PubChem CID | 139190935 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2)[C@H]1[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14ClNO4/c18-12-5-1-10(2-6-12)14-9-15(20)16(14)17(21)11-3-7-13(8-4-11)19(22)23/h1-8,14,16-17,21H,9H2/t14-,16-,17-/m1/s1 |
| InChIKey | LQYGWHVQWUKGDS-DJIMGWMZSA-N |
| XLogP | 3.65 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one?
The IUPAC name of cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one (CID 139190935) is cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one.
What is the SMILES notation for cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one?
The canonical SMILES for cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one is O=C1C[C@H](c2ccc(Cl)cc2)[C@H]1[C@H](O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one?
The InChIKey is LQYGWHVQWUKGDS-DJIMGWMZSA-N. The full InChI is InChI=1S/C17H14ClNO4/c18-12-5-1-10(2-6-12)14-9-15(20)16(14)17(21)11-3-7-13(8-4-11)19(22)23/h1-8,14,16-17,21H,9H2/t14-,16-,17-/m1/s1.
What are the key properties of cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one?
cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one has a molecular weight of 331.76 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3S)-3-(4-chlorophenyl)-2-[(S)-hydroxy-(4-nitrophenyl)methyl]cyclobutan-1-one is sourced from PubChem (CID 139190935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).