C13H20O6 — CID 11778004
(1R,3R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecan-8-ol (PubChem CID 11778004) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1R,3R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecan-8-ol.
| Compound Name | (1R,3R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecan-8-ol |
|---|---|
| PubChem CID | 11778004 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (1R,3R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecan-8-ol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C[C@H]4OCCCC4(O)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H20O6/c1-12(2)17-10-9-7(16-11(10)19-12)6-8-13(14,18-9)4-3-5-15-8/h7-11,14H,3-6H2,1-2H3/t7-,8-,9+,10-,11-,13?/m1/s1 |
| InChIKey | YQQBXMSAHRSCQD-PCGQUTTJSA-N |
| XLogP | 0.52 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |