C13H14BBrO5 — CID 540824
(6-bromo-3-phenyl-2,4,7-trioxa-3-borabicyclo[3.3.1]nonan-9-yl) acetate (PubChem CID 540824) has the molecular formula C13H14BBrO5 and a molecular weight of 340.97 g/mol. Its IUPAC name is (6-bromo-3-phenyl-2,4,7-trioxa-3-borabicyclo[3.3.1]nonan-9-yl) acetate.
| Compound Name | (6-bromo-3-phenyl-2,4,7-trioxa-3-borabicyclo[3.3.1]nonan-9-yl) acetate |
|---|---|
| PubChem CID | 540824 |
| Molecular Formula | C13H14BBrO5 |
| Molecular Weight | 340.97 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (6-bromo-3-phenyl-2,4,7-trioxa-3-borabicyclo[3.3.1]nonan-9-yl) acetate |
| SMILES | CC(=O)OC1C2COC(Br)C1OB(c1ccccc1)O2 |
| InChI | InChI=1S/C13H14BBrO5/c1-8(16)18-11-10-7-17-13(15)12(11)20-14(19-10)9-5-3-2-4-6-9/h2-6,10-13H,7H2,1H3 |
| InChIKey | WEPXNZQXKRHLHE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.97 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|