C14H17BO6 — CID 539935
[5-(acetyloxymethyl)-2-phenyl-1,3,2-dioxaborolan-4-yl]methyl acetate (PubChem CID 539935) has the molecular formula C14H17BO6 and a molecular weight of 292.10 g/mol. Its IUPAC name is [5-(acetyloxymethyl)-2-phenyl-1,3,2-dioxaborolan-4-yl]methyl acetate.
| Compound Name | [5-(acetyloxymethyl)-2-phenyl-1,3,2-dioxaborolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 539935 |
| Molecular Formula | C14H17BO6 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [5-(acetyloxymethyl)-2-phenyl-1,3,2-dioxaborolan-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1OB(c2ccccc2)OC1COC(C)=O |
| InChI | InChI=1S/C14H17BO6/c1-10(16)18-8-13-14(9-19-11(2)17)21-15(20-13)12-6-4-3-5-7-12/h3-7,13-14H,8-9H2,1-2H3 |
| InChIKey | FBSZPXFBGKQUSQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|