C17H19BO2 — CID 99864585
(4R,6R)-4,6-dimethyl-2,5-diphenyl-1,3,2-dioxaborinane (PubChem CID 99864585) has the molecular formula C17H19BO2 and a molecular weight of 266.15 g/mol. Its IUPAC name is (4R,6R)-4,6-dimethyl-2,5-diphenyl-1,3,2-dioxaborinane.
| Compound Name | (4R,6R)-4,6-dimethyl-2,5-diphenyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 99864585 |
| Molecular Formula | C17H19BO2 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (4R,6R)-4,6-dimethyl-2,5-diphenyl-1,3,2-dioxaborinane |
| SMILES | C[C@H]1OB(c2ccccc2)O[C@H](C)C1c1ccccc1 |
| InChI | InChI=1S/C17H19BO2/c1-13-17(15-9-5-3-6-10-15)14(2)20-18(19-13)16-11-7-4-8-12-16/h3-14,17H,1-2H3/t13-,14-/m1/s1 |
| InChIKey | DPXZSTGHDSUTMC-ZIAGYGMSSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|