C23H23BO2 — CID 10925905
(4S,5R,6R)-4,5-dimethyl-2,4,6-triphenyl-1,3,2-dioxaborinane (PubChem CID 10925905) has the molecular formula C23H23BO2 and a molecular weight of 342.25 g/mol. Its IUPAC name is (4S,5R,6R)-4,5-dimethyl-2,4,6-triphenyl-1,3,2-dioxaborinane.
| Compound Name | (4S,5R,6R)-4,5-dimethyl-2,4,6-triphenyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 10925905 |
| Molecular Formula | C23H23BO2 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4S,5R,6R)-4,5-dimethyl-2,4,6-triphenyl-1,3,2-dioxaborinane |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OB(c2ccccc2)O[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C23H23BO2/c1-18-22(19-12-6-3-7-13-19)25-24(21-16-10-5-11-17-21)26-23(18,2)20-14-8-4-9-15-20/h3-18,22H,1-2H3/t18-,22-,23+/m1/s1 |
| InChIKey | QNWCJZHQFMZEJN-YSZBQJHXSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|