C16H18BNO2 — CID 12033964
4,6-dimethyl-2,5-diphenyl-1,3,4,2-dioxazaborinane (PubChem CID 12033964) has the molecular formula C16H18BNO2 and a molecular weight of 267.14 g/mol. Its IUPAC name is 4,6-dimethyl-2,5-diphenyl-1,3,4,2-dioxazaborinane.
| Compound Name | 4,6-dimethyl-2,5-diphenyl-1,3,4,2-dioxazaborinane |
|---|---|
| PubChem CID | 12033964 |
| Molecular Formula | C16H18BNO2 |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4,6-dimethyl-2,5-diphenyl-1,3,4,2-dioxazaborinane |
| SMILES | CC1OB(c2ccccc2)ON(C)C1c1ccccc1 |
| InChI | InChI=1S/C16H18BNO2/c1-13-16(14-9-5-3-6-10-14)18(2)20-17(19-13)15-11-7-4-8-12-15/h3-13,16H,1-2H3 |
| InChIKey | UOUUQESXXAYLEF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|