C12H20BNO2 — CID 144746462
ethane;3-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 144746462) has the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. Its IUPAC name is ethane;3-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | ethane;3-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 144746462 |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | ethane;3-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC.CC1OB(c2cccnc2)OC1(C)C |
| InChI | InChI=1S/C10H14BNO2.C2H6/c1-8-10(2,3)14-11(13-8)9-5-4-6-12-7-9;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | KIELBRWCSWEJQD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|