C15H25BN2O2S — CID 143020133
ethane;N-[3-ethenyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-methylthiohydroxylamine (PubChem CID 143020133) has the molecular formula C15H25BN2O2S and a molecular weight of 308.26 g/mol. Its IUPAC name is ethane;N-[3-ethenyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-methylthiohydroxylamine.
| Compound Name | ethane;N-[3-ethenyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-methylthiohydroxylamine |
|---|---|
| PubChem CID | 143020133 |
| Molecular Formula | C15H25BN2O2S |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethane;N-[3-ethenyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-N-methylthiohydroxylamine |
| SMILES | C=Cc1cc(B2OC(C)C(C)(C)O2)cnc1N(C)S.CC |
| InChI | InChI=1S/C13H19BN2O2S.C2H6/c1-6-10-7-11(8-15-12(10)16(5)19)14-17-9(2)13(3,4)18-14;1-2/h6-9,19H,1H2,2-5H3;1-2H3 |
| InChIKey | KXYDEUHRGFSTNH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|