C12H14BNO3 — CID 91927727
5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazole (PubChem CID 91927727) has the molecular formula C12H14BNO3 and a molecular weight of 231.06 g/mol. Its IUPAC name is 5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazole.
| Compound Name | 5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 91927727 |
| Molecular Formula | C12H14BNO3 |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazole |
| SMILES | CC1OB(c2ccc3oncc3c2)OC1(C)C |
| InChI | InChI=1S/C12H14BNO3/c1-8-12(2,3)17-13(15-8)10-4-5-11-9(6-10)7-14-16-11/h4-8H,1-3H3 |
| InChIKey | MWBHBRHIWSCXET-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|