C25H39BF3NO3 — CID 140847357
N,N-dihexyl-2-(trifluoromethyl)-4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 140847357) has the molecular formula C25H39BF3NO3 and a molecular weight of 469.40 g/mol. Its IUPAC name is N,N-dihexyl-2-(trifluoromethyl)-4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N,N-dihexyl-2-(trifluoromethyl)-4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 140847357 |
| Molecular Formula | C25H39BF3NO3 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | N,N-dihexyl-2-(trifluoromethyl)-4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1ccc(B2OC(C)C(C)(C)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H39BF3NO3/c1-6-8-10-12-16-30(17-13-11-9-7-2)23(31)21-15-14-20(18-22(21)25(27,28)29)26-32-19(3)24(4,5)33-26/h14-15,18-19H,6-13,16-17H2,1-5H3 |
| InChIKey | NPUAYJJFLSVTHW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|