C17H26BNO2 — CID 143907052
2-propyl-7-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 143907052) has the molecular formula C17H26BNO2 and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-propyl-7-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-propyl-7-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143907052 |
| Molecular Formula | C17H26BNO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 2-propyl-7-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCN1CCc2ccc(B3OC(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C17H26BNO2/c1-5-9-19-10-8-14-6-7-16(11-15(14)12-19)18-20-13(2)17(3,4)21-18/h6-7,11,13H,5,8-10,12H2,1-4H3 |
| InChIKey | RQMLYSQEBLDBJB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|