C20H29BN2O3 — CID 175633849
1-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroisoindol-2-yl]ethyl]pyrrolidin-2-one (PubChem CID 175633849) has the molecular formula C20H29BN2O3 and a molecular weight of 356.28 g/mol. Its IUPAC name is 1-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroisoindol-2-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroisoindol-2-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 175633849 |
| Molecular Formula | C20H29BN2O3 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroisoindol-2-yl]ethyl]pyrrolidin-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)CN(CCN2CCCC2=O)C3)OC1(C)C |
| InChI | InChI=1S/C20H29BN2O3/c1-19(2)20(3,4)26-21(25-19)17-8-7-15-13-22(14-16(15)12-17)10-11-23-9-5-6-18(23)24/h7-8,12H,5-6,9-11,13-14H2,1-4H3 |
| InChIKey | ITPVETYISYIALG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|