C17H26BN3O3 — CID 140726665
4-[2-[5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]ethyl]piperazine-1-carbaldehyde (PubChem CID 140726665) has the molecular formula C17H26BN3O3 and a molecular weight of 331.22 g/mol. Its IUPAC name is 4-[2-[5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]ethyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]ethyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 140726665 |
| Molecular Formula | C17H26BN3O3 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 4-[2-[5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]ethyl]piperazine-1-carbaldehyde |
| SMILES | CC1OB(c2ccc(CCN3CCN(C=O)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H26BN3O3/c1-14-17(2,3)24-18(23-14)15-4-5-16(19-12-15)6-7-20-8-10-21(13-22)11-9-20/h4-5,12-14H,6-11H2,1-3H3 |
| InChIKey | TWPLHUZZYVOLCQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|