C17H18B3N3O3 — CID 143111998
3-(4,6-dipyridin-3-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine;ethane (PubChem CID 143111998) has the molecular formula C17H18B3N3O3 and a molecular weight of 344.79 g/mol. Its IUPAC name is 3-(4,6-dipyridin-3-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine;ethane.
| Compound Name | 3-(4,6-dipyridin-3-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine;ethane |
|---|---|
| PubChem CID | 143111998 |
| Molecular Formula | C17H18B3N3O3 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-(4,6-dipyridin-3-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine;ethane |
| SMILES | CC.c1cncc(B2OB(c3cccnc3)OB(c3cccnc3)O2)c1 |
| InChI | InChI=1S/C15H12B3N3O3.C2H6/c1-4-13(10-19-7-1)16-22-17(14-5-2-8-20-11-14)24-18(23-16)15-6-3-9-21-12-15;1-2/h1-12H;1-2H3 |
| InChIKey | PNCVXGWTGCOBGN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|