C11H15BN2O4S — CID 141384752
3-[4,4,5-trimethyl-5-[(sulfonylamino)methyl]-1,3,2-dioxaborolan-2-yl]pyridine (PubChem CID 141384752) has the molecular formula C11H15BN2O4S and a molecular weight of 282.13 g/mol. Its IUPAC name is 3-[4,4,5-trimethyl-5-[(sulfonylamino)methyl]-1,3,2-dioxaborolan-2-yl]pyridine.
| Compound Name | 3-[4,4,5-trimethyl-5-[(sulfonylamino)methyl]-1,3,2-dioxaborolan-2-yl]pyridine |
|---|---|
| PubChem CID | 141384752 |
| Molecular Formula | C11H15BN2O4S |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-[4,4,5-trimethyl-5-[(sulfonylamino)methyl]-1,3,2-dioxaborolan-2-yl]pyridine |
| SMILES | CC1(C)OB(c2cccnc2)OC1(C)CN=S(=O)=O |
| InChI | InChI=1S/C11H15BN2O4S/c1-10(2)11(3,8-14-19(15)16)18-12(17-10)9-5-4-6-13-7-9/h4-7H,8H2,1-3H3 |
| InChIKey | OFJIOSSQQQPDRP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|