C21H27BO2 — CID 101126754
(4R,5S,6S)-4-ethyl-5-methyl-2,6-diphenyl-4-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 101126754) has the molecular formula C21H27BO2 and a molecular weight of 322.26 g/mol. Its IUPAC name is (4R,5S,6S)-4-ethyl-5-methyl-2,6-diphenyl-4-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | (4R,5S,6S)-4-ethyl-5-methyl-2,6-diphenyl-4-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 101126754 |
| Molecular Formula | C21H27BO2 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4R,5S,6S)-4-ethyl-5-methyl-2,6-diphenyl-4-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC[C@]1(C(C)C)OB(c2ccccc2)O[C@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H27BO2/c1-5-21(16(2)3)17(4)20(18-12-8-6-9-13-18)23-22(24-21)19-14-10-7-11-15-19/h6-17,20H,5H2,1-4H3/t17-,20-,21+/m0/s1 |
| InChIKey | SWTRAMWSXLZDED-DZFGPLHGSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|