C26H21BO6 — CID 23260602
(1S,17S)-17-ethyl-3,14-dihydroxy-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione (PubChem CID 23260602) has the molecular formula C26H21BO6 and a molecular weight of 440.26 g/mol. Its IUPAC name is (1S,17S)-17-ethyl-3,14-dihydroxy-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione.
| Compound Name | (1S,17S)-17-ethyl-3,14-dihydroxy-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione |
|---|---|
| PubChem CID | 23260602 |
| Molecular Formula | C26H21BO6 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (1S,17S)-17-ethyl-3,14-dihydroxy-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione |
| SMILES | CC[C@]12Cc3c(O)c4c(c(O)c3[C@H](C1)OB(c1ccccc1)O2)C(=O)c1ccccc1C4=O |
| InChI | InChI=1S/C26H21BO6/c1-2-26-12-17-19(18(13-26)32-27(33-26)14-8-4-3-5-9-14)25(31)21-20(24(17)30)22(28)15-10-6-7-11-16(15)23(21)29/h3-11,18,30-31H,2,12-13H2,1H3/t18-,26-/m0/s1 |
| InChIKey | MIIRDRIUFSCCGT-QYBDOPJKSA-N |
| XLogP | 3.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|