C32H28B2O8 — CID 70457653
[(1S,3S)-3-ethyl-5,12-dihydroxy-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid (PubChem CID 70457653) has the molecular formula C32H28B2O8 and a molecular weight of 562.19 g/mol. Its IUPAC name is [(1S,3S)-3-ethyl-5,12-dihydroxy-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid.
| Compound Name | [(1S,3S)-3-ethyl-5,12-dihydroxy-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid |
|---|---|
| PubChem CID | 70457653 |
| Molecular Formula | C32H28B2O8 |
| Molecular Weight | 562.19 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | [(1S,3S)-3-ethyl-5,12-dihydroxy-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid |
| SMILES | CC[C@]1(OB(O)c2ccccc2)Cc2c(O)c3c(c(O)c2[C@@H](OB(O)c2ccccc2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C32H28B2O8/c1-2-32(42-34(40)20-13-7-4-8-14-20)17-23-25(24(18-32)41-33(39)19-11-5-3-6-12-19)31(38)27-26(30(23)37)28(35)21-15-9-10-16-22(21)29(27)36/h3-16,24,37-40H,2,17-18H2,1H3/t24-,32-/m0/s1 |
| InChIKey | HNFNOSXQANZLMT-BNHRFMORSA-N |
| XLogP | 2.82 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|