C12H15BO2 — CID 135044453
(3aS,6aR)-2-hydroxy-6a-phenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[d]oxaborole (PubChem CID 135044453) has the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. Its IUPAC name is (3aS,6aR)-2-hydroxy-6a-phenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[d]oxaborole.
| Compound Name | (3aS,6aR)-2-hydroxy-6a-phenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[d]oxaborole |
|---|---|
| PubChem CID | 135044453 |
| Molecular Formula | C12H15BO2 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3aS,6aR)-2-hydroxy-6a-phenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[d]oxaborole |
| SMILES | OB1C[C@H]2CCC[C@@]2(c2ccccc2)O1 |
| InChI | InChI=1S/C12H15BO2/c14-13-9-11-7-4-8-12(11,15-13)10-5-2-1-3-6-10/h1-3,5-6,11,14H,4,7-9H2/t11-,12+/m1/s1 |
| InChIKey | ZOXHZIZEWXSHNT-NEPJUHHUSA-N |
| XLogP | 2.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|