C20H32NO2+ — CID 46188794
[(2S,6S)-6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl]methyl-trimethylazanium (PubChem CID 46188794) has the molecular formula C20H32NO2+ and a molecular weight of 318.48 g/mol. Its IUPAC name is [(2S,6S)-6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl]methyl-trimethylazanium.
| Compound Name | [(2S,6S)-6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 46188794 |
| Molecular Formula | C20H32NO2+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(2S,6S)-6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl]methyl-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@H]1COC[C@@](c2ccccc2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C20H32NO2/c1-21(2,3)14-19-15-22-16-20(23-19,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-7,10-11,18-19H,5,8-9,12-16H2,1-3H3/q+1/t19-,20+/m0/s1 |
| InChIKey | UFSZYKLBZJNXLV-VQTJNVASSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|