C18H23BO2 — CID 100936941
4-methyl-6-phenyl-3,14-dioxa-2-boratricyclo[5.3.3.12,6]tetradec-4-ene (PubChem CID 100936941) has the molecular formula C18H23BO2 and a molecular weight of 282.19 g/mol. Its IUPAC name is 4-methyl-6-phenyl-3,14-dioxa-2-boratricyclo[5.3.3.12,6]tetradec-4-ene.
| Compound Name | 4-methyl-6-phenyl-3,14-dioxa-2-boratricyclo[5.3.3.12,6]tetradec-4-ene |
|---|---|
| PubChem CID | 100936941 |
| Molecular Formula | C18H23BO2 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-methyl-6-phenyl-3,14-dioxa-2-boratricyclo[5.3.3.12,6]tetradec-4-ene |
| SMILES | CC1=CC2(c3ccccc3)OB(O1)C1CCCC2CCC1 |
| InChI | InChI=1S/C18H23BO2/c1-14-13-18(15-7-3-2-4-8-15)16-9-5-11-17(12-6-10-16)19(20-14)21-18/h2-4,7-8,13,16-17H,5-6,9-12H2,1H3 |
| InChIKey | HWLANGSRJGHMEE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|