C16H23BF2O2 — CID 157033634
2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;difluoromethylbenzene (PubChem CID 157033634) has the molecular formula C16H23BF2O2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;difluoromethylbenzene.
| Compound Name | 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;difluoromethylbenzene |
|---|---|
| PubChem CID | 157033634 |
| Molecular Formula | C16H23BF2O2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;difluoromethylbenzene |
| SMILES | CC1(C)OB(C2CC2)OC1(C)C.FC(F)c1ccccc1 |
| InChI | InChI=1S/C9H17BO2.C7H6F2/c1-8(2)9(3,4)12-10(11-8)7-5-6-7;8-7(9)6-4-2-1-3-5-6/h7H,5-6H2,1-4H3;1-5,7H |
| InChIKey | WCJRIYOFAMGRTJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|