C14H20NO+ — CID 166441566
(4aS,8aS)-8a-phenyl-2,3,4,4a,5,6,7,8-octahydrobenzo[b][1,4]oxazin-4-ium (PubChem CID 166441566) has the molecular formula C14H20NO+ and a molecular weight of 218.32 g/mol. Its IUPAC name is (4aS,8aS)-8a-phenyl-2,3,4,4a,5,6,7,8-octahydrobenzo[b][1,4]oxazin-4-ium.
| Compound Name | (4aS,8aS)-8a-phenyl-2,3,4,4a,5,6,7,8-octahydrobenzo[b][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 166441566 |
| Molecular Formula | C14H20NO+ |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (4aS,8aS)-8a-phenyl-2,3,4,4a,5,6,7,8-octahydrobenzo[b][1,4]oxazin-4-ium |
| SMILES | c1ccc([C@@]23CCCC[C@@H]2[NH2+]CCO3)cc1 |
| InChI | InChI=1S/C14H19NO/c1-2-6-12(7-3-1)14-9-5-4-8-13(14)15-10-11-16-14/h1-3,6-7,13,15H,4-5,8-11H2/p+1/t13-,14-/m0/s1 |
| InChIKey | WUQAXWFHUPEDCH-KBPBESRZSA-O |
| XLogP | 1.42 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |