C20H22O2 — CID 135074848
(1R,6R,7R)-1-phenyl-6-phenylmethoxy-8-oxabicyclo[5.1.0]octane (PubChem CID 135074848) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,6R,7R)-1-phenyl-6-phenylmethoxy-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1R,6R,7R)-1-phenyl-6-phenylmethoxy-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 135074848 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1R,6R,7R)-1-phenyl-6-phenylmethoxy-8-oxabicyclo[5.1.0]octane |
| SMILES | c1ccc(CO[C@@H]2CCCC[C@]3(c4ccccc4)O[C@H]23)cc1 |
| InChI | InChI=1S/C20H22O2/c1-3-9-16(10-4-1)15-21-18-13-7-8-14-20(19(18)22-20)17-11-5-2-6-12-17/h1-6,9-12,18-19H,7-8,13-15H2/t18-,19-,20-/m1/s1 |
| InChIKey | DPNKZFNOWVUOGB-VAMGGRTRSA-N |
| XLogP | 4.44 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|