C20H26O4 — CID 10958483
(1R,2R,8R,9S)-5-cyclohexyl-2-phenyl-3,4,6,7-tetraoxatricyclo[7.2.1.02,8]dodecane (PubChem CID 10958483) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1R,2R,8R,9S)-5-cyclohexyl-2-phenyl-3,4,6,7-tetraoxatricyclo[7.2.1.02,8]dodecane.
| Compound Name | (1R,2R,8R,9S)-5-cyclohexyl-2-phenyl-3,4,6,7-tetraoxatricyclo[7.2.1.02,8]dodecane |
|---|---|
| PubChem CID | 10958483 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1R,2R,8R,9S)-5-cyclohexyl-2-phenyl-3,4,6,7-tetraoxatricyclo[7.2.1.02,8]dodecane |
| SMILES | c1ccc([C@@]23OOC(C4CCCCC4)OO[C@@H]2[C@H]2CC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C20H26O4/c1-3-7-14(8-4-1)19-22-21-18-15-11-12-17(13-15)20(18,24-23-19)16-9-5-2-6-10-16/h2,5-6,9-10,14-15,17-19H,1,3-4,7-8,11-13H2/t15-,17+,18+,19?,20-/m0/s1 |
| InChIKey | COADCJGMCLNEBK-GSIQVPGLSA-N |
| XLogP | 4.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|