C17H19IO2 — CID 72551420
(1R,4S,5R)-4-cyclohexyl-5-iodo-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 72551420) has the molecular formula C17H19IO2 and a molecular weight of 382.24 g/mol. Its IUPAC name is (1R,4S,5R)-4-cyclohexyl-5-iodo-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5R)-4-cyclohexyl-5-iodo-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 72551420 |
| Molecular Formula | C17H19IO2 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | (1R,4S,5R)-4-cyclohexyl-5-iodo-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1O[C@@H](C2CCCCC2)[C@@]2(I)C[C@@]12c1ccccc1 |
| InChI | InChI=1S/C17H19IO2/c18-17-11-16(17,13-9-5-2-6-10-13)15(19)20-14(17)12-7-3-1-4-8-12/h2,5-6,9-10,12,14H,1,3-4,7-8,11H2/t14-,16+,17-/m0/s1 |
| InChIKey | GGZZZANYCNZOME-UAGQMJEPSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|