C13H14OS3 — CID 139053364
(1R,2R,4R,6R,7S)-2-phenyl-3,4λ4,5-trithiatricyclo[5.2.1.02,6]decane 4-oxide (PubChem CID 139053364) has the molecular formula C13H14OS3 and a molecular weight of 282.45 g/mol. Its IUPAC name is (1R,2R,4R,6R,7S)-2-phenyl-3,4λ4,5-trithiatricyclo[5.2.1.02,6]decane 4-oxide.
| Compound Name | (1R,2R,4R,6R,7S)-2-phenyl-3,4λ4,5-trithiatricyclo[5.2.1.02,6]decane 4-oxide |
|---|---|
| PubChem CID | 139053364 |
| Molecular Formula | C13H14OS3 |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (1R,2R,4R,6R,7S)-2-phenyl-3,4λ4,5-trithiatricyclo[5.2.1.02,6]decane 4-oxide |
| SMILES | O=[S@@]1S[C@@H]2[C@H]3CC[C@H](C3)[C@]2(c2ccccc2)S1 |
| InChI | InChI=1S/C13H14OS3/c14-17-15-12-9-6-7-11(8-9)13(12,16-17)10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2/t9-,11+,12+,13-,17+/m0/s1 |
| InChIKey | VPRYMHDSGOFMDD-CPCNZPCVSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|