C16H20O4 — CID 10564398
(1R,2R,10R,11S)-2-phenyl-3,4,8,9-tetraoxatricyclo[9.2.1.02,10]tetradecane (PubChem CID 10564398) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1R,2R,10R,11S)-2-phenyl-3,4,8,9-tetraoxatricyclo[9.2.1.02,10]tetradecane.
| Compound Name | (1R,2R,10R,11S)-2-phenyl-3,4,8,9-tetraoxatricyclo[9.2.1.02,10]tetradecane |
|---|---|
| PubChem CID | 10564398 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1R,2R,10R,11S)-2-phenyl-3,4,8,9-tetraoxatricyclo[9.2.1.02,10]tetradecane |
| SMILES | c1ccc([C@@]23OOCCCOO[C@@H]2[C@H]2CC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C16H20O4/c1-2-5-13(6-3-1)16-14-8-7-12(11-14)15(16)19-17-9-4-10-18-20-16/h1-3,5-6,12,14-15H,4,7-11H2/t12-,14+,15+,16-/m0/s1 |
| InChIKey | FGNUKCUKECFEBN-XZDPQHSOSA-N |
| XLogP | 2.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|