About azane;3-phenyldioxane;hydrochloride
azane;3-phenyldioxane;hydrochloride (PubChem CID 174853974) has the molecular formula C10H16ClNO2
and a molecular weight of 217.70 g/mol. Its IUPAC name is azane;3-phenyldioxane;hydrochloride.
Molecular Properties
| Compound Name | azane;3-phenyldioxane;hydrochloride |
| PubChem CID | 174853974 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | azane;3-phenyldioxane;hydrochloride |
| SMILES | Cl.N.c1ccc(C2CCCOO2)cc1 |
| InChI | InChI=1S/C10H12O2.ClH.H3N/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;;/h1-3,5-6,10H,4,7-8H2;1H;1H3 |
| InChIKey | CGOWRQAAAWSBRW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze azane;3-phenyldioxane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-phenyldioxane;hydrochloride?
The IUPAC name of azane;3-phenyldioxane;hydrochloride (CID 174853974) is azane;3-phenyldioxane;hydrochloride.
What is the SMILES notation for azane;3-phenyldioxane;hydrochloride?
The canonical SMILES for azane;3-phenyldioxane;hydrochloride is Cl.N.c1ccc(C2CCCOO2)cc1.
What is the InChIKey of azane;3-phenyldioxane;hydrochloride?
The InChIKey is CGOWRQAAAWSBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.ClH.H3N/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;;/h1-3,5-6,10H,4,7-8H2;1H;1H3.
What are the key properties of azane;3-phenyldioxane;hydrochloride?
azane;3-phenyldioxane;hydrochloride has a molecular weight of 217.70 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-phenyldioxane;hydrochloride is sourced from PubChem (CID 174853974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).