C17H23Cl2N — CID 54601333
(1R,2R,6S,7S)-4-(2-chloroethyl)-2-phenyl-4-azatricyclo[5.2.1.02,6]decane;hydrochloride (PubChem CID 54601333) has the molecular formula C17H23Cl2N and a molecular weight of 312.28 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-(2-chloroethyl)-2-phenyl-4-azatricyclo[5.2.1.02,6]decane;hydrochloride.
| Compound Name | (1R,2R,6S,7S)-4-(2-chloroethyl)-2-phenyl-4-azatricyclo[5.2.1.02,6]decane;hydrochloride |
|---|---|
| PubChem CID | 54601333 |
| Molecular Formula | C17H23Cl2N |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (1R,2R,6S,7S)-4-(2-chloroethyl)-2-phenyl-4-azatricyclo[5.2.1.02,6]decane;hydrochloride |
| SMILES | Cl.ClCCN1C[C@H]2[C@H]3CC[C@H](C3)[C@@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C17H22ClN.ClH/c18-8-9-19-11-16-13-6-7-15(10-13)17(16,12-19)14-4-2-1-3-5-14;/h1-5,13,15-16H,6-12H2;1H/t13-,15+,16-,17-;/m0./s1 |
| InChIKey | DOLHQQJMUDGYSN-MYBLIBQASA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|