C16H18O — CID 583150
4a-phenyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 583150) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 4a-phenyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | 4a-phenyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 583150 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4a-phenyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | O=C1C=CC2(c3ccccc3)CCCCC2C1 |
| InChI | InChI=1S/C16H18O/c17-15-9-11-16(13-6-2-1-3-7-13)10-5-4-8-14(16)12-15/h1-3,6-7,9,11,14H,4-5,8,10,12H2 |
| InChIKey | YORKEPLOWDEWFD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |