C18H24N2 — CID 174475257
4-cyclohexyl-4-phenylcyclohexa-2,5-diene-1,1-diamine (PubChem CID 174475257) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-cyclohexyl-4-phenylcyclohexa-2,5-diene-1,1-diamine.
| Compound Name | 4-cyclohexyl-4-phenylcyclohexa-2,5-diene-1,1-diamine |
|---|---|
| PubChem CID | 174475257 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-cyclohexyl-4-phenylcyclohexa-2,5-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(c2ccccc2)(C2CCCCC2)C=C1 |
| InChI | InChI=1S/C18H24N2/c19-18(20)13-11-17(12-14-18,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1,3-4,7-8,11-14,16H,2,5-6,9-10,19-20H2 |
| InChIKey | QYSNHYNWZUXUHN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|