C16H22O2S — CID 141442231
2-cyclohexyl-2-phenylthiolane 1,1-dioxide (PubChem CID 141442231) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-cyclohexyl-2-phenylthiolane 1,1-dioxide.
| Compound Name | 2-cyclohexyl-2-phenylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 141442231 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-cyclohexyl-2-phenylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H22O2S/c17-19(18)13-7-12-16(19,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1,3-4,8-9,15H,2,5-7,10-13H2 |
| InChIKey | YPDIDTJIOLUPQR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |