C17H20O3S — CID 11347264
(4aR,8aS)-3-(benzenesulfonyl)-4a-methyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 11347264) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is (4aR,8aS)-3-(benzenesulfonyl)-4a-methyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (4aR,8aS)-3-(benzenesulfonyl)-4a-methyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 11347264 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (4aR,8aS)-3-(benzenesulfonyl)-4a-methyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | C[C@]12C=C(S(=O)(=O)c3ccccc3)C(=O)C[C@@H]1CCCC2 |
| InChI | InChI=1S/C17H20O3S/c1-17-10-6-5-7-13(17)11-15(18)16(12-17)21(19,20)14-8-3-2-4-9-14/h2-4,8-9,12-13H,5-7,10-11H2,1H3/t13-,17-/m0/s1 |
| InChIKey | KFTQMPQUTIIHJX-GUYCJALGSA-N |
| XLogP | 3.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |