C24H28O5S2 — CID 10906649
(3aR,7aR)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1,4,5,6,7,7a-hexahydroinden-3a-ol (PubChem CID 10906649) has the molecular formula C24H28O5S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3aR,7aR)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1,4,5,6,7,7a-hexahydroinden-3a-ol.
| Compound Name | (3aR,7aR)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1,4,5,6,7,7a-hexahydroinden-3a-ol |
|---|---|
| PubChem CID | 10906649 |
| Molecular Formula | C24H28O5S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (3aR,7aR)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1,4,5,6,7,7a-hexahydroinden-3a-ol |
| SMILES | CC1=C(CC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C[C@H]2CCCC[C@]12O |
| InChI | InChI=1S/C24H28O5S2/c1-18-19(16-20-10-8-9-15-24(18,20)25)17-23(30(26,27)21-11-4-2-5-12-21)31(28,29)22-13-6-3-7-14-22/h2-7,11-14,20,23,25H,8-10,15-17H2,1H3/t20-,24+/m1/s1 |
| InChIKey | NPYPVTCDJPUQBY-YKSBVNFPSA-N |
| XLogP | 4.29 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|