C31H38O3S — CID 134981790
(E)-4-(benzenesulfonyl)-3,9-dimethyl-1,11-diphenylundec-8-en-3-ol (PubChem CID 134981790) has the molecular formula C31H38O3S and a molecular weight of 490.71 g/mol. Its IUPAC name is (E)-4-(benzenesulfonyl)-3,9-dimethyl-1,11-diphenylundec-8-en-3-ol.
| Compound Name | (E)-4-(benzenesulfonyl)-3,9-dimethyl-1,11-diphenylundec-8-en-3-ol |
|---|---|
| PubChem CID | 134981790 |
| Molecular Formula | C31H38O3S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (E)-4-(benzenesulfonyl)-3,9-dimethyl-1,11-diphenylundec-8-en-3-ol |
| SMILES | C/C(=C\CCCC(C(C)(O)CCc1ccccc1)S(=O)(=O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C31H38O3S/c1-26(22-23-27-15-6-3-7-16-27)14-12-13-21-30(35(33,34)29-19-10-5-11-20-29)31(2,32)25-24-28-17-8-4-9-18-28/h3-11,14-20,30,32H,12-13,21-25H2,1-2H3/b26-14+ |
| InChIKey | PKFPFCYEXXKDGZ-VULFUBBASA-N |
| XLogP | 6.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|