C27H34O5S2 — CID 134955826
(2R)-2-[(1R,2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentyl]-6-methylhept-5-en-2-ol (PubChem CID 134955826) has the molecular formula C27H34O5S2 and a molecular weight of 502.70 g/mol. Its IUPAC name is (2R)-2-[(1R,2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentyl]-6-methylhept-5-en-2-ol.
| Compound Name | (2R)-2-[(1R,2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentyl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 134955826 |
| Molecular Formula | C27H34O5S2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (2R)-2-[(1R,2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentyl]-6-methylhept-5-en-2-ol |
| SMILES | C=C[C@@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]1[C@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C27H34O5S2/c1-5-22-19-27(33(29,30)23-14-8-6-9-15-23,34(31,32)24-16-10-7-11-17-24)20-25(22)26(4,28)18-12-13-21(2)3/h5-11,13-17,22,25,28H,1,12,18-20H2,2-4H3/t22-,25-,26-/m1/s1 |
| InChIKey | KUTKBVYCVDWPBU-DNRSQYFGSA-N |
| XLogP | 5.34 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|